C29H30N4O3S — CID 135572421
N-benzyl-2-[[8,8-dimethyl-5-(4-methylphenyl)-4,6-dioxo-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinolin-2-yl]sulfanyl]acetamide (PubChem CID 135572421) has the molecular formula C29H30N4O3S and a molecular weight of 514.65 g/mol. Its IUPAC name is N-benzyl-2-[[8,8-dimethyl-5-(4-methylphenyl)-4,6-dioxo-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinolin-2-yl]sulfanyl]acetamide.
| Compound Name | N-benzyl-2-[[8,8-dimethyl-5-(4-methylphenyl)-4,6-dioxo-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinolin-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 135572421 |
| Molecular Formula | C29H30N4O3S |
| Molecular Weight | 514.65 g/mol |
| Exact Mass | 514.20 |
| IUPAC Name | N-benzyl-2-[[8,8-dimethyl-5-(4-methylphenyl)-4,6-dioxo-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinolin-2-yl]sulfanyl]acetamide |
| SMILES | Cc1ccc(C2C3=C(CC(C)(C)CC3=O)Nc3nc(SCC(=O)NCc4ccccc4)[nH]c(=O)c32)cc1 |
| InChI | InChI=1S/C29H30N4O3S/c1-17-9-11-19(12-10-17)23-24-20(13-29(2,3)14-21(24)34)31-26-25(23)27(36)33-28(32-26)37-16-22(35)30-15-18-7-5-4-6-8-18/h4-12,23H,13-16H2,1-3H3,(H,30,35)(H2,31,32,33,36) |
| InChIKey | YRRRKBFZAYDUOR-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.65 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |