C11H10N2O3 — CID 135573284
2-methyl-7,8-dihydro-3H-[1,4]dioxino[2,3-g]quinazolin-4-one (PubChem CID 135573284) has the molecular formula C11H10N2O3 and a molecular weight of 218.21 g/mol. Its IUPAC name is 2-methyl-7,8-dihydro-3H-[1,4]dioxino[2,3-g]quinazolin-4-one.
| Compound Name | 2-methyl-7,8-dihydro-3H-[1,4]dioxino[2,3-g]quinazolin-4-one |
|---|---|
| PubChem CID | 135573284 |
| Molecular Formula | C11H10N2O3 |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | 2-methyl-7,8-dihydro-3H-[1,4]dioxino[2,3-g]quinazolin-4-one |
| SMILES | Cc1nc2cc3c(cc2c(=O)[nH]1)OCCO3 |
| InChI | InChI=1S/C11H10N2O3/c1-6-12-8-5-10-9(15-2-3-16-10)4-7(8)11(14)13-6/h4-5H,2-3H2,1H3,(H,12,13,14) |
| InChIKey | OPSBTQKDBCTKSL-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |