C17H14N2O4S — CID 2810066
N-(6,7-dimethoxy-4-oxo-3,1-benzothiazin-2-yl)benzamide (PubChem CID 2810066) has the molecular formula C17H14N2O4S and a molecular weight of 342.38 g/mol. Its IUPAC name is N-(6,7-dimethoxy-4-oxo-3,1-benzothiazin-2-yl)benzamide.
| Compound Name | N-(6,7-dimethoxy-4-oxo-3,1-benzothiazin-2-yl)benzamide |
|---|---|
| PubChem CID | 2810066 |
| Molecular Formula | C17H14N2O4S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | N-(6,7-dimethoxy-4-oxo-3,1-benzothiazin-2-yl)benzamide |
| SMILES | COc1cc2nc(NC(=O)c3ccccc3)sc(=O)c2cc1OC |
| InChI | InChI=1S/C17H14N2O4S/c1-22-13-8-11-12(9-14(13)23-2)18-17(24-16(11)21)19-15(20)10-6-4-3-5-7-10/h3-9H,1-2H3,(H,18,19,20) |
| InChIKey | KTABESZSOYKGKF-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |