C15H12N2O6 — CID 135573756
4-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]benzoic acid (PubChem CID 135573756) has the molecular formula C15H12N2O6 and a molecular weight of 316.27 g/mol. Its IUPAC name is 4-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]benzoic acid.
| Compound Name | 4-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]benzoic acid |
|---|---|
| PubChem CID | 135573756 |
| Molecular Formula | C15H12N2O6 |
| Molecular Weight | 316.27 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 4-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]benzoic acid |
| SMILES | COc1cc(/C=N/c2ccc(C(=O)O)cc2)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C15H12N2O6/c1-23-13-7-9(6-12(14(13)18)17(21)22)8-16-11-4-2-10(3-5-11)15(19)20/h2-8,18H,1H3,(H,19,20)/b16-8+ |
| InChIKey | KGZWULUEPOSODY-LZYBPNLTSA-N |
| XLogP | 2.76 |
| TPSA | 122.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.27 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|