C29H27N7O4 — CID 135574119
3-[2-[[4-[[1-(2-ethoxyethyl)benzimidazol-2-yl]methoxy]phenyl]methyl]tetrazol-5-yl]-6-hydroxy-1H-quinolin-2-one (PubChem CID 135574119) has the molecular formula C29H27N7O4 and a molecular weight of 537.58 g/mol. Its IUPAC name is 3-[2-[[4-[[1-(2-ethoxyethyl)benzimidazol-2-yl]methoxy]phenyl]methyl]tetrazol-5-yl]-6-hydroxy-1H-quinolin-2-one.
| Compound Name | 3-[2-[[4-[[1-(2-ethoxyethyl)benzimidazol-2-yl]methoxy]phenyl]methyl]tetrazol-5-yl]-6-hydroxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 135574119 |
| Molecular Formula | C29H27N7O4 |
| Molecular Weight | 537.58 g/mol |
| Exact Mass | 537.21 |
| IUPAC Name | 3-[2-[[4-[[1-(2-ethoxyethyl)benzimidazol-2-yl]methoxy]phenyl]methyl]tetrazol-5-yl]-6-hydroxy-1H-quinolin-2-one |
| SMILES | CCOCCn1c(COc2ccc(Cn3nnc(-c4cc5cc(O)ccc5[nH]c4=O)n3)cc2)nc2ccccc21 |
| InChI | InChI=1S/C29H27N7O4/c1-2-39-14-13-35-26-6-4-3-5-25(26)30-27(35)18-40-22-10-7-19(8-11-22)17-36-33-28(32-34-36)23-16-20-15-21(37)9-12-24(20)31-29(23)38/h3-12,15-16,37H,2,13-14,17-18H2,1H3,(H,31,38) |
| InChIKey | AAHBXZJCVZFZJJ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 132.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.58 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|