C19H13N3O5S3 — CID 135574795
methyl 3-[(E)-[(5E)-4-oxo-5-(quinolin-6-ylmethylidene)-1,3-thiazolidin-2-ylidene]amino]sulfonylthiophene-2-carboxylate (PubChem CID 135574795) has the molecular formula C19H13N3O5S3 and a molecular weight of 459.53 g/mol. Its IUPAC name is methyl 3-[(E)-[(5E)-4-oxo-5-(quinolin-6-ylmethylidene)-1,3-thiazolidin-2-ylidene]amino]sulfonylthiophene-2-carboxylate.
| Compound Name | methyl 3-[(E)-[(5E)-4-oxo-5-(quinolin-6-ylmethylidene)-1,3-thiazolidin-2-ylidene]amino]sulfonylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 135574795 |
| Molecular Formula | C19H13N3O5S3 |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.00 |
| IUPAC Name | methyl 3-[(E)-[(5E)-4-oxo-5-(quinolin-6-ylmethylidene)-1,3-thiazolidin-2-ylidene]amino]sulfonylthiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1S(=O)(=O)/N=C1\NC(=O)/C(=C\c2ccc3ncccc3c2)S1 |
| InChI | InChI=1S/C19H13N3O5S3/c1-27-18(24)16-15(6-8-28-16)30(25,26)22-19-21-17(23)14(29-19)10-11-4-5-13-12(9-11)3-2-7-20-13/h2-10H,1H3,(H,21,22,23)/b14-10+ |
| InChIKey | TUYZXHAGAPZHCX-GXDHUFHOSA-N |
| XLogP | 3.03 |
| TPSA | 114.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|