C22H19BrN2O3 — CID 135575157
5-bromo-7-methyl-1-(3-naphthalen-2-yloxypropyl)-3-nitrosoindol-2-ol (PubChem CID 135575157) has the molecular formula C22H19BrN2O3 and a molecular weight of 439.31 g/mol. Its IUPAC name is 5-bromo-7-methyl-1-(3-naphthalen-2-yloxypropyl)-3-nitrosoindol-2-ol.
| Compound Name | 5-bromo-7-methyl-1-(3-naphthalen-2-yloxypropyl)-3-nitrosoindol-2-ol |
|---|---|
| PubChem CID | 135575157 |
| Molecular Formula | C22H19BrN2O3 |
| Molecular Weight | 439.31 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | 5-bromo-7-methyl-1-(3-naphthalen-2-yloxypropyl)-3-nitrosoindol-2-ol |
| SMILES | Cc1cc(Br)cc2c(N=O)c(O)n(CCCOc3ccc4ccccc4c3)c12 |
| InChI | InChI=1S/C22H19BrN2O3/c1-14-11-17(23)13-19-20(24-27)22(26)25(21(14)19)9-4-10-28-18-8-7-15-5-2-3-6-16(15)12-18/h2-3,5-8,11-13,26H,4,9-10H2,1H3 |
| InChIKey | MIJUHSPBEABYAP-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 63.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.31 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|