C21H23BrN2O3 — CID 135575114
5-bromo-7-methyl-3-nitroso-1-[(2-pentoxyphenyl)methyl]indol-2-ol (PubChem CID 135575114) has the molecular formula C21H23BrN2O3 and a molecular weight of 431.33 g/mol. Its IUPAC name is 5-bromo-7-methyl-3-nitroso-1-[(2-pentoxyphenyl)methyl]indol-2-ol.
| Compound Name | 5-bromo-7-methyl-3-nitroso-1-[(2-pentoxyphenyl)methyl]indol-2-ol |
|---|---|
| PubChem CID | 135575114 |
| Molecular Formula | C21H23BrN2O3 |
| Molecular Weight | 431.33 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | 5-bromo-7-methyl-3-nitroso-1-[(2-pentoxyphenyl)methyl]indol-2-ol |
| SMILES | CCCCCOc1ccccc1Cn1c(O)c(N=O)c2cc(Br)cc(C)c21 |
| InChI | InChI=1S/C21H23BrN2O3/c1-3-4-7-10-27-18-9-6-5-8-15(18)13-24-20-14(2)11-16(22)12-17(20)19(23-26)21(24)25/h5-6,8-9,11-12,25H,3-4,7,10,13H2,1-2H3 |
| InChIKey | KGPMNKOELNZJBP-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 63.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.33 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|