C24H18F2N6O — CID 135575348
2,7-bis(4-fluorophenyl)-5-methyl-N-pyridin-3-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135575348) has the molecular formula C24H18F2N6O and a molecular weight of 444.45 g/mol. Its IUPAC name is 2,7-bis(4-fluorophenyl)-5-methyl-N-pyridin-3-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 2,7-bis(4-fluorophenyl)-5-methyl-N-pyridin-3-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135575348 |
| Molecular Formula | C24H18F2N6O |
| Molecular Weight | 444.45 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | 2,7-bis(4-fluorophenyl)-5-methyl-N-pyridin-3-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)Nc2cccnc2)C(c2ccc(F)cc2)n2nc(-c3ccc(F)cc3)nc2N1 |
| InChI | InChI=1S/C24H18F2N6O/c1-14-20(23(33)29-19-3-2-12-27-13-19)21(15-4-8-17(25)9-5-15)32-24(28-14)30-22(31-32)16-6-10-18(26)11-7-16/h2-13,21H,1H3,(H,29,33)(H,28,30,31) |
| InChIKey | BATFXKXEIMOBGE-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.45 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |