C24H18Cl2N6O2 — CID 135593068
2-(3,4-dichlorophenyl)-7-(4-hydroxyphenyl)-5-methyl-N-pyridin-3-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135593068) has the molecular formula C24H18Cl2N6O2 and a molecular weight of 493.35 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-7-(4-hydroxyphenyl)-5-methyl-N-pyridin-3-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 2-(3,4-dichlorophenyl)-7-(4-hydroxyphenyl)-5-methyl-N-pyridin-3-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135593068 |
| Molecular Formula | C24H18Cl2N6O2 |
| Molecular Weight | 493.35 g/mol |
| Exact Mass | 492.09 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-7-(4-hydroxyphenyl)-5-methyl-N-pyridin-3-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)Nc2cccnc2)C(c2ccc(O)cc2)n2nc(-c3ccc(Cl)c(Cl)c3)nc2N1 |
| InChI | InChI=1S/C24H18Cl2N6O2/c1-13-20(23(34)29-16-3-2-10-27-12-16)21(14-4-7-17(33)8-5-14)32-24(28-13)30-22(31-32)15-6-9-18(25)19(26)11-15/h2-12,21,33H,1H3,(H,29,34)(H,28,30,31) |
| InChIKey | DEBPYTQZGKGYIT-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.35 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |