C33H29N5O3 — CID 135575554
7-(4-methoxy-3-phenylmethoxyphenyl)-5-methyl-N,2-diphenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135575554) has the molecular formula C33H29N5O3 and a molecular weight of 543.63 g/mol. Its IUPAC name is 7-(4-methoxy-3-phenylmethoxyphenyl)-5-methyl-N,2-diphenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 7-(4-methoxy-3-phenylmethoxyphenyl)-5-methyl-N,2-diphenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135575554 |
| Molecular Formula | C33H29N5O3 |
| Molecular Weight | 543.63 g/mol |
| Exact Mass | 543.23 |
| IUPAC Name | 7-(4-methoxy-3-phenylmethoxyphenyl)-5-methyl-N,2-diphenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | COc1ccc(C2C(C(=O)Nc3ccccc3)=C(C)Nc3nc(-c4ccccc4)nn32)cc1OCc1ccccc1 |
| InChI | InChI=1S/C33H29N5O3/c1-22-29(32(39)35-26-16-10-5-11-17-26)30(38-33(34-22)36-31(37-38)24-14-8-4-9-15-24)25-18-19-27(40-2)28(20-25)41-21-23-12-6-3-7-13-23/h3-20,30H,21H2,1-2H3,(H,35,39)(H,34,36,37) |
| InChIKey | JQWBKYSSFNRBNJ-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.63 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |