C34H30N6O5 — CID 135551367
7-(3-ethoxy-4-phenylmethoxyphenyl)-5-methyl-2-(3-nitrophenyl)-N-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135551367) has the molecular formula C34H30N6O5 and a molecular weight of 602.65 g/mol. Its IUPAC name is 7-(3-ethoxy-4-phenylmethoxyphenyl)-5-methyl-2-(3-nitrophenyl)-N-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 7-(3-ethoxy-4-phenylmethoxyphenyl)-5-methyl-2-(3-nitrophenyl)-N-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135551367 |
| Molecular Formula | C34H30N6O5 |
| Molecular Weight | 602.65 g/mol |
| Exact Mass | 602.23 |
| IUPAC Name | 7-(3-ethoxy-4-phenylmethoxyphenyl)-5-methyl-2-(3-nitrophenyl)-N-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CCOc1cc(C2C(C(=O)Nc3ccccc3)=C(C)Nc3nc(-c4cccc([N+](=O)[O-])c4)nn32)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C34H30N6O5/c1-3-44-29-20-24(17-18-28(29)45-21-23-11-6-4-7-12-23)31-30(33(41)36-26-14-8-5-9-15-26)22(2)35-34-37-32(38-39(31)34)25-13-10-16-27(19-25)40(42)43/h4-20,31H,3,21H2,1-2H3,(H,36,41)(H,35,37,38) |
| InChIKey | ZTJITVOPVWZFFQ-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 133.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.65 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|