C31H25N7O4 — CID 135594342
5-methyl-2-(3-nitrophenyl)-7-(3-phenylmethoxyphenyl)-N-pyridin-3-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135594342) has the molecular formula C31H25N7O4 and a molecular weight of 559.59 g/mol. Its IUPAC name is 5-methyl-2-(3-nitrophenyl)-7-(3-phenylmethoxyphenyl)-N-pyridin-3-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 5-methyl-2-(3-nitrophenyl)-7-(3-phenylmethoxyphenyl)-N-pyridin-3-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135594342 |
| Molecular Formula | C31H25N7O4 |
| Molecular Weight | 559.59 g/mol |
| Exact Mass | 559.20 |
| IUPAC Name | 5-methyl-2-(3-nitrophenyl)-7-(3-phenylmethoxyphenyl)-N-pyridin-3-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)Nc2cccnc2)C(c2cccc(OCc3ccccc3)c2)n2nc(-c3cccc([N+](=O)[O-])c3)nc2N1 |
| InChI | InChI=1S/C31H25N7O4/c1-20-27(30(39)34-24-12-7-15-32-18-24)28(22-10-6-14-26(17-22)42-19-21-8-3-2-4-9-21)37-31(33-20)35-29(36-37)23-11-5-13-25(16-23)38(40)41/h2-18,28H,19H2,1H3,(H,34,39)(H,33,35,36) |
| InChIKey | WUHUCBZMJRYNET-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 137.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.59 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|