C33H28N6O5 — CID 135692866
N-(2-methoxyphenyl)-5-methyl-2-(3-nitrophenyl)-7-(3-phenylmethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135692866) has the molecular formula C33H28N6O5 and a molecular weight of 588.62 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-5-methyl-2-(3-nitrophenyl)-7-(3-phenylmethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | N-(2-methoxyphenyl)-5-methyl-2-(3-nitrophenyl)-7-(3-phenylmethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135692866 |
| Molecular Formula | C33H28N6O5 |
| Molecular Weight | 588.62 g/mol |
| Exact Mass | 588.21 |
| IUPAC Name | N-(2-methoxyphenyl)-5-methyl-2-(3-nitrophenyl)-7-(3-phenylmethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | COc1ccccc1NC(=O)C1=C(C)Nc2nc(-c3cccc([N+](=O)[O-])c3)nn2C1c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C33H28N6O5/c1-21-29(32(40)35-27-16-6-7-17-28(27)43-2)30(23-12-9-15-26(19-23)44-20-22-10-4-3-5-11-22)38-33(34-21)36-31(37-38)24-13-8-14-25(18-24)39(41)42/h3-19,30H,20H2,1-2H3,(H,35,40)(H,34,36,37) |
| InChIKey | JORBVPJMDBMMJN-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 133.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.62 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|