C28H26N6O6 — CID 135841013
2-(3,4-dimethoxyphenyl)-N-(2-methoxyphenyl)-5-methyl-7-(3-nitrophenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135841013) has the molecular formula C28H26N6O6 and a molecular weight of 542.55 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-(2-methoxyphenyl)-5-methyl-7-(3-nitrophenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-(2-methoxyphenyl)-5-methyl-7-(3-nitrophenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135841013 |
| Molecular Formula | C28H26N6O6 |
| Molecular Weight | 542.55 g/mol |
| Exact Mass | 542.19 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-(2-methoxyphenyl)-5-methyl-7-(3-nitrophenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | COc1ccccc1NC(=O)C1=C(C)Nc2nc(-c3ccc(OC)c(OC)c3)nn2C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H26N6O6/c1-16-24(27(35)30-20-10-5-6-11-21(20)38-2)25(17-8-7-9-19(14-17)34(36)37)33-28(29-16)31-26(32-33)18-12-13-22(39-3)23(15-18)40-4/h5-15,25H,1-4H3,(H,30,35)(H,29,31,32) |
| InChIKey | ZWMFQAAOUYNTTJ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 142.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.55 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|