C29H29N5O6 — CID 135832441
7-(3-hydroxyphenyl)-N-(2-methoxyphenyl)-5-methyl-2-(3,4,5-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135832441) has the molecular formula C29H29N5O6 and a molecular weight of 543.58 g/mol. Its IUPAC name is 7-(3-hydroxyphenyl)-N-(2-methoxyphenyl)-5-methyl-2-(3,4,5-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 7-(3-hydroxyphenyl)-N-(2-methoxyphenyl)-5-methyl-2-(3,4,5-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135832441 |
| Molecular Formula | C29H29N5O6 |
| Molecular Weight | 543.58 g/mol |
| Exact Mass | 543.21 |
| IUPAC Name | 7-(3-hydroxyphenyl)-N-(2-methoxyphenyl)-5-methyl-2-(3,4,5-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | COc1ccccc1NC(=O)C1=C(C)Nc2nc(-c3cc(OC)c(OC)c(OC)c3)nn2C1c1cccc(O)c1 |
| InChI | InChI=1S/C29H29N5O6/c1-16-24(28(36)31-20-11-6-7-12-21(20)37-2)25(17-9-8-10-19(35)13-17)34-29(30-16)32-27(33-34)18-14-22(38-3)26(40-5)23(15-18)39-4/h6-15,25,35H,1-5H3,(H,31,36)(H,30,32,33) |
| InChIKey | DGUWESONFUNOLI-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 128.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.58 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |