C31H33N5O5 — CID 135554116
2-(3,4-dimethylphenyl)-N-(2-methoxyphenyl)-5-methyl-7-(3,4,5-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135554116) has the molecular formula C31H33N5O5 and a molecular weight of 555.64 g/mol. Its IUPAC name is 2-(3,4-dimethylphenyl)-N-(2-methoxyphenyl)-5-methyl-7-(3,4,5-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 2-(3,4-dimethylphenyl)-N-(2-methoxyphenyl)-5-methyl-7-(3,4,5-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135554116 |
| Molecular Formula | C31H33N5O5 |
| Molecular Weight | 555.64 g/mol |
| Exact Mass | 555.25 |
| IUPAC Name | 2-(3,4-dimethylphenyl)-N-(2-methoxyphenyl)-5-methyl-7-(3,4,5-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | COc1ccccc1NC(=O)C1=C(C)Nc2nc(-c3ccc(C)c(C)c3)nn2C1c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C31H33N5O5/c1-17-12-13-20(14-18(17)2)29-34-31-32-19(3)26(30(37)33-22-10-8-9-11-23(22)38-4)27(36(31)35-29)21-15-24(39-5)28(41-7)25(16-21)40-6/h8-16,27H,1-7H3,(H,33,37)(H,32,34,35) |
| InChIKey | QPXVIIBZMMVWBU-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 108.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.64 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |