C32H29N5O4 — CID 135843331
7-(3,4-dimethoxyphenyl)-N-(2-methoxyphenyl)-5-methyl-2-naphthalen-1-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135843331) has the molecular formula C32H29N5O4 and a molecular weight of 547.62 g/mol. Its IUPAC name is 7-(3,4-dimethoxyphenyl)-N-(2-methoxyphenyl)-5-methyl-2-naphthalen-1-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 7-(3,4-dimethoxyphenyl)-N-(2-methoxyphenyl)-5-methyl-2-naphthalen-1-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135843331 |
| Molecular Formula | C32H29N5O4 |
| Molecular Weight | 547.62 g/mol |
| Exact Mass | 547.22 |
| IUPAC Name | 7-(3,4-dimethoxyphenyl)-N-(2-methoxyphenyl)-5-methyl-2-naphthalen-1-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | COc1ccccc1NC(=O)C1=C(C)Nc2nc(-c3cccc4ccccc34)nn2C1c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C32H29N5O4/c1-19-28(31(38)34-24-14-7-8-15-25(24)39-2)29(21-16-17-26(40-3)27(18-21)41-4)37-32(33-19)35-30(36-37)23-13-9-11-20-10-5-6-12-22(20)23/h5-18,29H,1-4H3,(H,34,38)(H,33,35,36) |
| InChIKey | YKMDGTLWRSYYTR-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 99.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.62 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |