C25H19N7O5 — CID 135600851
5-methyl-2-(3-nitrophenyl)-7-(4-nitrophenyl)-N-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135600851) has the molecular formula C25H19N7O5 and a molecular weight of 497.47 g/mol. Its IUPAC name is 5-methyl-2-(3-nitrophenyl)-7-(4-nitrophenyl)-N-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 5-methyl-2-(3-nitrophenyl)-7-(4-nitrophenyl)-N-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135600851 |
| Molecular Formula | C25H19N7O5 |
| Molecular Weight | 497.47 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | 5-methyl-2-(3-nitrophenyl)-7-(4-nitrophenyl)-N-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccccc2)C(c2ccc([N+](=O)[O-])cc2)n2nc(-c3cccc([N+](=O)[O-])c3)nc2N1 |
| InChI | InChI=1S/C25H19N7O5/c1-15-21(24(33)27-18-7-3-2-4-8-18)22(16-10-12-19(13-11-16)31(34)35)30-25(26-15)28-23(29-30)17-6-5-9-20(14-17)32(36)37/h2-14,22H,1H3,(H,27,33)(H,26,28,29) |
| InChIKey | XOWHJNYCQWXNKE-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 158.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.47 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|