C23H18N6O3S — CID 135709603
5-methyl-2-(3-nitrophenyl)-N-phenyl-7-thiophen-2-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135709603) has the molecular formula C23H18N6O3S and a molecular weight of 458.50 g/mol. Its IUPAC name is 5-methyl-2-(3-nitrophenyl)-N-phenyl-7-thiophen-2-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 5-methyl-2-(3-nitrophenyl)-N-phenyl-7-thiophen-2-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135709603 |
| Molecular Formula | C23H18N6O3S |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | 5-methyl-2-(3-nitrophenyl)-N-phenyl-7-thiophen-2-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccccc2)C(c2cccs2)n2nc(-c3cccc([N+](=O)[O-])c3)nc2N1 |
| InChI | InChI=1S/C23H18N6O3S/c1-14-19(22(30)25-16-8-3-2-4-9-16)20(18-11-6-12-33-18)28-23(24-14)26-21(27-28)15-7-5-10-17(13-15)29(31)32/h2-13,20H,1H3,(H,25,30)(H,24,26,27) |
| InChIKey | YSBZRHRWQNXHOT-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 114.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|