C25H19ClN6O3 — CID 1181662
(7S)-2-(2-chlorophenyl)-5-methyl-7-(3-nitrophenyl)-N-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 1181662) has the molecular formula C25H19ClN6O3 and a molecular weight of 486.92 g/mol. Its IUPAC name is (7S)-2-(2-chlorophenyl)-5-methyl-7-(3-nitrophenyl)-N-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | (7S)-2-(2-chlorophenyl)-5-methyl-7-(3-nitrophenyl)-N-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 1181662 |
| Molecular Formula | C25H19ClN6O3 |
| Molecular Weight | 486.92 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | (7S)-2-(2-chlorophenyl)-5-methyl-7-(3-nitrophenyl)-N-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccccc2)[C@H](c2cccc([N+](=O)[O-])c2)n2nc(-c3ccccc3Cl)nc2N1 |
| InChI | InChI=1S/C25H19ClN6O3/c1-15-21(24(33)28-17-9-3-2-4-10-17)22(16-8-7-11-18(14-16)32(34)35)31-25(27-15)29-23(30-31)19-12-5-6-13-20(19)26/h2-14,22H,1H3,(H,28,33)(H,27,29,30)/t22-/m0/s1 |
| InChIKey | BRFVOJWUVASFGX-QFIPXVFZSA-N |
| XLogP | 5.43 |
| TPSA | 114.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.92 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|