C20H14ClF3N6O3 — CID 135936463
N-(4-chlorophenyl)-5-methyl-7-(3-nitrophenyl)-2-(trifluoromethyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135936463) has the molecular formula C20H14ClF3N6O3 and a molecular weight of 478.82 g/mol. Its IUPAC name is N-(4-chlorophenyl)-5-methyl-7-(3-nitrophenyl)-2-(trifluoromethyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | N-(4-chlorophenyl)-5-methyl-7-(3-nitrophenyl)-2-(trifluoromethyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135936463 |
| Molecular Formula | C20H14ClF3N6O3 |
| Molecular Weight | 478.82 g/mol |
| Exact Mass | 478.08 |
| IUPAC Name | N-(4-chlorophenyl)-5-methyl-7-(3-nitrophenyl)-2-(trifluoromethyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccc(Cl)cc2)C(c2cccc([N+](=O)[O-])c2)n2nc(C(F)(F)F)nc2N1 |
| InChI | InChI=1S/C20H14ClF3N6O3/c1-10-15(17(31)26-13-7-5-12(21)6-8-13)16(11-3-2-4-14(9-11)30(32)33)29-19(25-10)27-18(28-29)20(22,23)24/h2-9,16H,1H3,(H,26,31)(H,25,27,28) |
| InChIKey | OHWYZJXCVFPKNB-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 114.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.82 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|