C22H19F3N6O3 — CID 136878475
(7S)-N-(2,4-dimethylphenyl)-5-methyl-7-(3-nitrophenyl)-2-(trifluoromethyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 136878475) has the molecular formula C22H19F3N6O3 and a molecular weight of 472.43 g/mol. Its IUPAC name is (7S)-N-(2,4-dimethylphenyl)-5-methyl-7-(3-nitrophenyl)-2-(trifluoromethyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | (7S)-N-(2,4-dimethylphenyl)-5-methyl-7-(3-nitrophenyl)-2-(trifluoromethyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 136878475 |
| Molecular Formula | C22H19F3N6O3 |
| Molecular Weight | 472.43 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | (7S)-N-(2,4-dimethylphenyl)-5-methyl-7-(3-nitrophenyl)-2-(trifluoromethyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccc(C)cc2C)[C@H](c2cccc([N+](=O)[O-])c2)n2nc(C(F)(F)F)nc2N1 |
| InChI | InChI=1S/C22H19F3N6O3/c1-11-7-8-16(12(2)9-11)27-19(32)17-13(3)26-21-28-20(22(23,24)25)29-30(21)18(17)14-5-4-6-15(10-14)31(33)34/h4-10,18H,1-3H3,(H,27,32)(H,26,28,29)/t18-/m0/s1 |
| InChIKey | RKKXCOGWUGVKOI-SFHVURJKSA-N |
| XLogP | 4.75 |
| TPSA | 114.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.43 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|