C22H19BrF3N5O — CID 136878473
(7S)-7-(3-bromophenyl)-N-(2,4-dimethylphenyl)-5-methyl-2-(trifluoromethyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 136878473) has the molecular formula C22H19BrF3N5O and a molecular weight of 506.33 g/mol. Its IUPAC name is (7S)-7-(3-bromophenyl)-N-(2,4-dimethylphenyl)-5-methyl-2-(trifluoromethyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | (7S)-7-(3-bromophenyl)-N-(2,4-dimethylphenyl)-5-methyl-2-(trifluoromethyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 136878473 |
| Molecular Formula | C22H19BrF3N5O |
| Molecular Weight | 506.33 g/mol |
| Exact Mass | 505.07 |
| IUPAC Name | (7S)-7-(3-bromophenyl)-N-(2,4-dimethylphenyl)-5-methyl-2-(trifluoromethyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccc(C)cc2C)[C@H](c2cccc(Br)c2)n2nc(C(F)(F)F)nc2N1 |
| InChI | InChI=1S/C22H19BrF3N5O/c1-11-7-8-16(12(2)9-11)28-19(32)17-13(3)27-21-29-20(22(24,25)26)30-31(21)18(17)14-5-4-6-15(23)10-14/h4-10,18H,1-3H3,(H,28,32)(H,27,29,30)/t18-/m0/s1 |
| InChIKey | NPACWDVTQDWFQN-SFHVURJKSA-N |
| XLogP | 5.60 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.33 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |