C23H22ClN5O3 — CID 136761908
methyl (7S)-7-(4-chlorophenyl)-6-[(2,4-dimethylphenyl)carbamoyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate (PubChem CID 136761908) has the molecular formula C23H22ClN5O3 and a molecular weight of 451.91 g/mol. Its IUPAC name is methyl (7S)-7-(4-chlorophenyl)-6-[(2,4-dimethylphenyl)carbamoyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate.
| Compound Name | methyl (7S)-7-(4-chlorophenyl)-6-[(2,4-dimethylphenyl)carbamoyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 136761908 |
| Molecular Formula | C23H22ClN5O3 |
| Molecular Weight | 451.91 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | methyl (7S)-7-(4-chlorophenyl)-6-[(2,4-dimethylphenyl)carbamoyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate |
| SMILES | COC(=O)c1nc2n(n1)[C@@H](c1ccc(Cl)cc1)C(C(=O)Nc1ccc(C)cc1C)=C(C)N2 |
| InChI | InChI=1S/C23H22ClN5O3/c1-12-5-10-17(13(2)11-12)26-21(30)18-14(3)25-23-27-20(22(31)32-4)28-29(23)19(18)15-6-8-16(24)9-7-15/h5-11,19H,1-4H3,(H,26,30)(H,25,27,28)/t19-/m0/s1 |
| InChIKey | NZRJPDJQQFOVAR-IBGZPJMESA-N |
| XLogP | 4.26 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.91 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |