C20H19N7O3 — CID 135660071
N-(2,3-dimethylphenyl)-5-methyl-7-(3-nitrophenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135660071) has the molecular formula C20H19N7O3 and a molecular weight of 405.42 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-5-methyl-7-(3-nitrophenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | N-(2,3-dimethylphenyl)-5-methyl-7-(3-nitrophenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135660071 |
| Molecular Formula | C20H19N7O3 |
| Molecular Weight | 405.42 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | N-(2,3-dimethylphenyl)-5-methyl-7-(3-nitrophenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)Nc2cccc(C)c2C)C(c2cccc([N+](=O)[O-])c2)n2nnnc2N1 |
| InChI | InChI=1S/C20H19N7O3/c1-11-6-4-9-16(12(11)2)22-19(28)17-13(3)21-20-23-24-25-26(20)18(17)14-7-5-8-15(10-14)27(29)30/h4-10,18H,1-3H3,(H,22,28)(H,21,23,25) |
| InChIKey | YGFBYQCMSNCBGI-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|