C19H17N7O3 — CID 2947474
5-methyl-N-(2-methylphenyl)-7-(3-nitrophenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 2947474) has the molecular formula C19H17N7O3 and a molecular weight of 391.39 g/mol. Its IUPAC name is 5-methyl-N-(2-methylphenyl)-7-(3-nitrophenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 5-methyl-N-(2-methylphenyl)-7-(3-nitrophenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 2947474 |
| Molecular Formula | C19H17N7O3 |
| Molecular Weight | 391.39 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 5-methyl-N-(2-methylphenyl)-7-(3-nitrophenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccccc2C)C(c2cccc([N+](=O)[O-])c2)n2nnnc2N1 |
| InChI | InChI=1S/C19H17N7O3/c1-11-6-3-4-9-15(11)21-18(27)16-12(2)20-19-22-23-24-25(19)17(16)13-7-5-8-14(10-13)26(28)29/h3-10,17H,1-2H3,(H,21,27)(H,20,22,24) |
| InChIKey | HZAGQXFUYUOXTN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.39 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|