C20H19N7O5 — CID 136865687
(7R)-N-(2,5-dimethoxyphenyl)-5-methyl-7-(3-nitrophenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 136865687) has the molecular formula C20H19N7O5 and a molecular weight of 437.42 g/mol. Its IUPAC name is (7R)-N-(2,5-dimethoxyphenyl)-5-methyl-7-(3-nitrophenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | (7R)-N-(2,5-dimethoxyphenyl)-5-methyl-7-(3-nitrophenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 136865687 |
| Molecular Formula | C20H19N7O5 |
| Molecular Weight | 437.42 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | (7R)-N-(2,5-dimethoxyphenyl)-5-methyl-7-(3-nitrophenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | COc1ccc(OC)c(NC(=O)C2=C(C)Nc3nnnn3[C@@H]2c2cccc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C20H19N7O5/c1-11-17(19(28)22-15-10-14(31-2)7-8-16(15)32-3)18(26-20(21-11)23-24-25-26)12-5-4-6-13(9-12)27(29)30/h4-10,18H,1-3H3,(H,22,28)(H,21,23,25)/t18-/m1/s1 |
| InChIKey | GHPXGANGDQIDSM-GOSISDBHSA-N |
| XLogP | 2.53 |
| TPSA | 146.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.42 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|