C20H18ClN7O5 — CID 136767578
(7R)-N-(4-chloro-2,5-dimethoxyphenyl)-5-methyl-7-(3-nitrophenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 136767578) has the molecular formula C20H18ClN7O5 and a molecular weight of 471.86 g/mol. Its IUPAC name is (7R)-N-(4-chloro-2,5-dimethoxyphenyl)-5-methyl-7-(3-nitrophenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | (7R)-N-(4-chloro-2,5-dimethoxyphenyl)-5-methyl-7-(3-nitrophenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 136767578 |
| Molecular Formula | C20H18ClN7O5 |
| Molecular Weight | 471.86 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | (7R)-N-(4-chloro-2,5-dimethoxyphenyl)-5-methyl-7-(3-nitrophenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | COc1cc(NC(=O)C2=C(C)Nc3nnnn3[C@@H]2c2cccc([N+](=O)[O-])c2)c(OC)cc1Cl |
| InChI | InChI=1S/C20H18ClN7O5/c1-10-17(19(29)23-14-9-15(32-2)13(21)8-16(14)33-3)18(27-20(22-10)24-25-26-27)11-5-4-6-12(7-11)28(30)31/h4-9,18H,1-3H3,(H,23,29)(H,22,24,26)/t18-/m1/s1 |
| InChIKey | KLDIKUPWJWZVTJ-GOSISDBHSA-N |
| XLogP | 3.18 |
| TPSA | 146.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.86 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|