C20H19ClN4O6 — CID 1298755
(4R)-N-(4-chloro-2,5-dimethoxyphenyl)-6-methyl-4-(3-nitrophenyl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxamide (PubChem CID 1298755) has the molecular formula C20H19ClN4O6 and a molecular weight of 446.85 g/mol. Its IUPAC name is (4R)-N-(4-chloro-2,5-dimethoxyphenyl)-6-methyl-4-(3-nitrophenyl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxamide.
| Compound Name | (4R)-N-(4-chloro-2,5-dimethoxyphenyl)-6-methyl-4-(3-nitrophenyl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 1298755 |
| Molecular Formula | C20H19ClN4O6 |
| Molecular Weight | 446.85 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | (4R)-N-(4-chloro-2,5-dimethoxyphenyl)-6-methyl-4-(3-nitrophenyl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxamide |
| SMILES | COc1cc(NC(=O)C2=C(C)NC(=O)N[C@@H]2c2cccc([N+](=O)[O-])c2)c(OC)cc1Cl |
| InChI | InChI=1S/C20H19ClN4O6/c1-10-17(19(26)23-14-9-15(30-2)13(21)8-16(14)31-3)18(24-20(27)22-10)11-5-4-6-12(7-11)25(28)29/h4-9,18H,1-3H3,(H,23,26)(H2,22,24,27)/t18-/m1/s1 |
| InChIKey | URCMOIZXSVZDFC-GOSISDBHSA-N |
| XLogP | 3.53 |
| TPSA | 131.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.85 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|