C21H18N6O7 — CID 137075983
methyl (7S)-6-(3,4-dimethoxybenzoyl)-7-(3-nitrophenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine-5-carboxylate (PubChem CID 137075983) has the molecular formula C21H18N6O7 and a molecular weight of 466.41 g/mol. Its IUPAC name is methyl (7S)-6-(3,4-dimethoxybenzoyl)-7-(3-nitrophenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine-5-carboxylate.
| Compound Name | methyl (7S)-6-(3,4-dimethoxybenzoyl)-7-(3-nitrophenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 137075983 |
| Molecular Formula | C21H18N6O7 |
| Molecular Weight | 466.41 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | methyl (7S)-6-(3,4-dimethoxybenzoyl)-7-(3-nitrophenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine-5-carboxylate |
| SMILES | COC(=O)C1=C(C(=O)c2ccc(OC)c(OC)c2)[C@H](c2cccc([N+](=O)[O-])c2)n2nnnc2N1 |
| InChI | InChI=1S/C21H18N6O7/c1-32-14-8-7-12(10-15(14)33-2)19(28)16-17(20(29)34-3)22-21-23-24-25-26(21)18(16)11-5-4-6-13(9-11)27(30)31/h4-10,18H,1-3H3,(H,22,23,25)/t18-/m0/s1 |
| InChIKey | FVXSYWIHLPTQQM-SFHVURJKSA-N |
| XLogP | 1.92 |
| TPSA | 160.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.41 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|