C17H12N6O5S — CID 137076033
methyl (7R)-7-(3-nitrophenyl)-6-(thiophene-2-carbonyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine-5-carboxylate (PubChem CID 137076033) has the molecular formula C17H12N6O5S and a molecular weight of 412.39 g/mol. Its IUPAC name is methyl (7R)-7-(3-nitrophenyl)-6-(thiophene-2-carbonyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine-5-carboxylate.
| Compound Name | methyl (7R)-7-(3-nitrophenyl)-6-(thiophene-2-carbonyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 137076033 |
| Molecular Formula | C17H12N6O5S |
| Molecular Weight | 412.39 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | methyl (7R)-7-(3-nitrophenyl)-6-(thiophene-2-carbonyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine-5-carboxylate |
| SMILES | COC(=O)C1=C(C(=O)c2cccs2)[C@@H](c2cccc([N+](=O)[O-])c2)n2nnnc2N1 |
| InChI | InChI=1S/C17H12N6O5S/c1-28-16(25)13-12(15(24)11-6-3-7-29-11)14(22-17(18-13)19-20-21-22)9-4-2-5-10(8-9)23(26)27/h2-8,14H,1H3,(H,18,19,21)/t14-/m1/s1 |
| InChIKey | FPXJAQWHDGYJCP-CQSZACIVSA-N |
| XLogP | 1.97 |
| TPSA | 142.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.39 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|