C20H16N6O5 — CID 137121760
methyl (7R)-6-(4-methylbenzoyl)-7-(3-nitrophenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine-5-carboxylate (PubChem CID 137121760) has the molecular formula C20H16N6O5 and a molecular weight of 420.39 g/mol. Its IUPAC name is methyl (7R)-6-(4-methylbenzoyl)-7-(3-nitrophenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine-5-carboxylate.
| Compound Name | methyl (7R)-6-(4-methylbenzoyl)-7-(3-nitrophenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 137121760 |
| Molecular Formula | C20H16N6O5 |
| Molecular Weight | 420.39 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | methyl (7R)-6-(4-methylbenzoyl)-7-(3-nitrophenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine-5-carboxylate |
| SMILES | COC(=O)C1=C(C(=O)c2ccc(C)cc2)[C@@H](c2cccc([N+](=O)[O-])c2)n2nnnc2N1 |
| InChI | InChI=1S/C20H16N6O5/c1-11-6-8-12(9-7-11)18(27)15-16(19(28)31-2)21-20-22-23-24-25(20)17(15)13-4-3-5-14(10-13)26(29)30/h3-10,17H,1-2H3,(H,21,22,24)/t17-/m1/s1 |
| InChIKey | UQAQLAQBPCEFLU-QGZVFWFLSA-N |
| XLogP | 2.21 |
| TPSA | 142.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.39 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|