C19H13ClN6O5 — CID 137075860
methyl (7S)-7-(4-chlorophenyl)-6-(3-nitrobenzoyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine-5-carboxylate (PubChem CID 137075860) has the molecular formula C19H13ClN6O5 and a molecular weight of 440.80 g/mol. Its IUPAC name is methyl (7S)-7-(4-chlorophenyl)-6-(3-nitrobenzoyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine-5-carboxylate.
| Compound Name | methyl (7S)-7-(4-chlorophenyl)-6-(3-nitrobenzoyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 137075860 |
| Molecular Formula | C19H13ClN6O5 |
| Molecular Weight | 440.80 g/mol |
| Exact Mass | 440.06 |
| IUPAC Name | methyl (7S)-7-(4-chlorophenyl)-6-(3-nitrobenzoyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine-5-carboxylate |
| SMILES | COC(=O)C1=C(C(=O)c2cccc([N+](=O)[O-])c2)[C@H](c2ccc(Cl)cc2)n2nnnc2N1 |
| InChI | InChI=1S/C19H13ClN6O5/c1-31-18(28)15-14(17(27)11-3-2-4-13(9-11)26(29)30)16(10-5-7-12(20)8-6-10)25-19(21-15)22-23-24-25/h2-9,16H,1H3,(H,21,22,24)/t16-/m0/s1 |
| InChIKey | JBAUWNOPCYKRME-INIZCTEOSA-N |
| XLogP | 2.56 |
| TPSA | 142.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.80 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|