C24H19N7O3 — CID 135698051
5-methyl-7-(3-nitrophenyl)-2-phenyl-N-pyridin-2-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135698051) has the molecular formula C24H19N7O3 and a molecular weight of 453.46 g/mol. Its IUPAC name is 5-methyl-7-(3-nitrophenyl)-2-phenyl-N-pyridin-2-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 5-methyl-7-(3-nitrophenyl)-2-phenyl-N-pyridin-2-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135698051 |
| Molecular Formula | C24H19N7O3 |
| Molecular Weight | 453.46 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | 5-methyl-7-(3-nitrophenyl)-2-phenyl-N-pyridin-2-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccccn2)C(c2cccc([N+](=O)[O-])c2)n2nc(-c3ccccc3)nc2N1 |
| InChI | InChI=1S/C24H19N7O3/c1-15-20(23(32)27-19-12-5-6-13-25-19)21(17-10-7-11-18(14-17)31(33)34)30-24(26-15)28-22(29-30)16-8-3-2-4-9-16/h2-14,21H,1H3,(H,25,27,32)(H,26,28,29) |
| InChIKey | HYQSXHLAQCCGHD-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.46 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|