C20H14Cl2F3N5O — CID 135572653
N,7-bis(4-chlorophenyl)-5-methyl-2-(trifluoromethyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135572653) has the molecular formula C20H14Cl2F3N5O and a molecular weight of 468.27 g/mol. Its IUPAC name is N,7-bis(4-chlorophenyl)-5-methyl-2-(trifluoromethyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | N,7-bis(4-chlorophenyl)-5-methyl-2-(trifluoromethyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135572653 |
| Molecular Formula | C20H14Cl2F3N5O |
| Molecular Weight | 468.27 g/mol |
| Exact Mass | 467.05 |
| IUPAC Name | N,7-bis(4-chlorophenyl)-5-methyl-2-(trifluoromethyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccc(Cl)cc2)C(c2ccc(Cl)cc2)n2nc(C(F)(F)F)nc2N1 |
| InChI | InChI=1S/C20H14Cl2F3N5O/c1-10-15(17(31)27-14-8-6-13(22)7-9-14)16(11-2-4-12(21)5-3-11)30-19(26-10)28-18(29-30)20(23,24)25/h2-9,16H,1H3,(H,27,31)(H,26,28,29) |
| InChIKey | USDFWJFNBHGNSG-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.27 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |