C15H13ClN6O2 — CID 135576402
2-chloro-7-methyl-3-[(E)-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)hydrazinylidene]methyl]pyrido[1,2-a]pyrimidin-4-one (PubChem CID 135576402) has the molecular formula C15H13ClN6O2 and a molecular weight of 344.76 g/mol. Its IUPAC name is 2-chloro-7-methyl-3-[(E)-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)hydrazinylidene]methyl]pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-chloro-7-methyl-3-[(E)-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)hydrazinylidene]methyl]pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 135576402 |
| Molecular Formula | C15H13ClN6O2 |
| Molecular Weight | 344.76 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 2-chloro-7-methyl-3-[(E)-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)hydrazinylidene]methyl]pyrido[1,2-a]pyrimidin-4-one |
| SMILES | Cc1ccc2nc(Cl)c(/C=N/Nc3nc(C)cc(=O)[nH]3)c(=O)n2c1 |
| InChI | InChI=1S/C15H13ClN6O2/c1-8-3-4-11-19-13(16)10(14(24)22(11)7-8)6-17-21-15-18-9(2)5-12(23)20-15/h3-7H,1-2H3,(H2,18,20,21,23)/b17-6+ |
| InChIKey | IKASKMOSORYOKB-UBKPWBPPSA-N |
| XLogP | 1.49 |
| TPSA | 104.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.76 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|