C14H17ClN6OS — CID 135722564
2-[(2Z)-2-[(4-chloro-2-piperidin-1-yl-1,3-thiazol-5-yl)methylidene]hydrazinyl]-4-methyl-1H-pyrimidin-6-one (PubChem CID 135722564) has the molecular formula C14H17ClN6OS and a molecular weight of 352.85 g/mol. Its IUPAC name is 2-[(2Z)-2-[(4-chloro-2-piperidin-1-yl-1,3-thiazol-5-yl)methylidene]hydrazinyl]-4-methyl-1H-pyrimidin-6-one.
| Compound Name | 2-[(2Z)-2-[(4-chloro-2-piperidin-1-yl-1,3-thiazol-5-yl)methylidene]hydrazinyl]-4-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135722564 |
| Molecular Formula | C14H17ClN6OS |
| Molecular Weight | 352.85 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 2-[(2Z)-2-[(4-chloro-2-piperidin-1-yl-1,3-thiazol-5-yl)methylidene]hydrazinyl]-4-methyl-1H-pyrimidin-6-one |
| SMILES | Cc1cc(=O)[nH]c(N/N=C\c2sc(N3CCCCC3)nc2Cl)n1 |
| InChI | InChI=1S/C14H17ClN6OS/c1-9-7-11(22)18-13(17-9)20-16-8-10-12(15)19-14(23-10)21-5-3-2-4-6-21/h7-8H,2-6H2,1H3,(H2,17,18,20,22)/b16-8- |
| InChIKey | YFAKLMJEBYVVIU-PXNMLYILSA-N |
| XLogP | 2.62 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.85 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|