C29H28ClN5O5 — CID 135579011
7-[2-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-N-(2,5-dimethoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135579011) has the molecular formula C29H28ClN5O5 and a molecular weight of 562.03 g/mol. Its IUPAC name is 7-[2-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-N-(2,5-dimethoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 7-[2-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-N-(2,5-dimethoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135579011 |
| Molecular Formula | C29H28ClN5O5 |
| Molecular Weight | 562.03 g/mol |
| Exact Mass | 561.18 |
| IUPAC Name | 7-[2-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-N-(2,5-dimethoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | COc1ccc(OC)c(NC(=O)C2=C(C)Nc3ncnn3C2c2cccc(OC)c2OCc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C29H28ClN5O5/c1-17-25(28(36)34-22-14-20(37-2)12-13-23(22)38-3)26(35-29(33-17)31-16-32-35)21-6-5-7-24(39-4)27(21)40-15-18-8-10-19(30)11-9-18/h5-14,16,26H,15H2,1-4H3,(H,34,36)(H,31,32,33) |
| InChIKey | KGYFTCOWVGXYJE-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 108.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.03 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |