C28H26ClN5O2 — CID 136828413
(7S)-7-[2-[(4-chlorophenyl)methoxy]phenyl]-N-(2,4-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 136828413) has the molecular formula C28H26ClN5O2 and a molecular weight of 500.00 g/mol. Its IUPAC name is (7S)-7-[2-[(4-chlorophenyl)methoxy]phenyl]-N-(2,4-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | (7S)-7-[2-[(4-chlorophenyl)methoxy]phenyl]-N-(2,4-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 136828413 |
| Molecular Formula | C28H26ClN5O2 |
| Molecular Weight | 500.00 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | (7S)-7-[2-[(4-chlorophenyl)methoxy]phenyl]-N-(2,4-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccc(C)cc2C)[C@H](c2ccccc2OCc2ccc(Cl)cc2)n2ncnc2N1 |
| InChI | InChI=1S/C28H26ClN5O2/c1-17-8-13-23(18(2)14-17)33-27(35)25-19(3)32-28-30-16-31-34(28)26(25)22-6-4-5-7-24(22)36-15-20-9-11-21(29)12-10-20/h4-14,16,26H,15H2,1-3H3,(H,33,35)(H,30,31,32)/t26-/m0/s1 |
| InChIKey | BFWMKNQFIKJSBN-SANMLTNESA-N |
| XLogP | 6.05 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.00 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |