C29H29N5O2 — CID 135877632
(7R)-N-(2,4-dimethylphenyl)-5-methyl-7-[4-[(4-methylphenyl)methoxy]phenyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135877632) has the molecular formula C29H29N5O2 and a molecular weight of 479.58 g/mol. Its IUPAC name is (7R)-N-(2,4-dimethylphenyl)-5-methyl-7-[4-[(4-methylphenyl)methoxy]phenyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | (7R)-N-(2,4-dimethylphenyl)-5-methyl-7-[4-[(4-methylphenyl)methoxy]phenyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135877632 |
| Molecular Formula | C29H29N5O2 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.23 |
| IUPAC Name | (7R)-N-(2,4-dimethylphenyl)-5-methyl-7-[4-[(4-methylphenyl)methoxy]phenyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccc(C)cc2C)[C@@H](c2ccc(OCc3ccc(C)cc3)cc2)n2ncnc2N1 |
| InChI | InChI=1S/C29H29N5O2/c1-18-5-8-22(9-6-18)16-36-24-12-10-23(11-13-24)27-26(21(4)32-29-30-17-31-34(27)29)28(35)33-25-14-7-19(2)15-20(25)3/h5-15,17,27H,16H2,1-4H3,(H,33,35)(H,30,31,32)/t27-/m1/s1 |
| InChIKey | SPEAIUYEDTWWLN-HHHXNRCGSA-N |
| XLogP | 5.71 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |