C28H26FN5O2 — CID 135642873
N-(2,4-dimethylphenyl)-7-[4-[(2-fluorophenyl)methoxy]phenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135642873) has the molecular formula C28H26FN5O2 and a molecular weight of 483.55 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-7-[4-[(2-fluorophenyl)methoxy]phenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | N-(2,4-dimethylphenyl)-7-[4-[(2-fluorophenyl)methoxy]phenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135642873 |
| Molecular Formula | C28H26FN5O2 |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.21 |
| IUPAC Name | N-(2,4-dimethylphenyl)-7-[4-[(2-fluorophenyl)methoxy]phenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccc(C)cc2C)C(c2ccc(OCc3ccccc3F)cc2)n2ncnc2N1 |
| InChI | InChI=1S/C28H26FN5O2/c1-17-8-13-24(18(2)14-17)33-27(35)25-19(3)32-28-30-16-31-34(28)26(25)20-9-11-22(12-10-20)36-15-21-6-4-5-7-23(21)29/h4-14,16,26H,15H2,1-3H3,(H,33,35)(H,30,31,32) |
| InChIKey | QFBGGFYYTZKQMD-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |