C29H28FN5O3 — CID 136824162
(7R)-N-(2,4-dimethylphenyl)-7-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 136824162) has the molecular formula C29H28FN5O3 and a molecular weight of 513.57 g/mol. Its IUPAC name is (7R)-N-(2,4-dimethylphenyl)-7-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | (7R)-N-(2,4-dimethylphenyl)-7-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 136824162 |
| Molecular Formula | C29H28FN5O3 |
| Molecular Weight | 513.57 g/mol |
| Exact Mass | 513.22 |
| IUPAC Name | (7R)-N-(2,4-dimethylphenyl)-7-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | COc1cc([C@@H]2C(C(=O)Nc3ccc(C)cc3C)=C(C)Nc3ncnn32)ccc1OCc1ccccc1F |
| InChI | InChI=1S/C29H28FN5O3/c1-17-9-11-23(18(2)13-17)34-28(36)26-19(3)33-29-31-16-32-35(29)27(26)20-10-12-24(25(14-20)37-4)38-15-21-7-5-6-8-22(21)30/h5-14,16,27H,15H2,1-4H3,(H,34,36)(H,31,32,33)/t27-/m1/s1 |
| InChIKey | PUNSHKMZQOJNGT-HHHXNRCGSA-N |
| XLogP | 5.55 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.57 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |