C32H29N5O2 — CID 135905917
(7R)-N-(2,4-dimethylphenyl)-5-methyl-7-[4-(naphthalen-1-ylmethoxy)phenyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135905917) has the molecular formula C32H29N5O2 and a molecular weight of 515.62 g/mol. Its IUPAC name is (7R)-N-(2,4-dimethylphenyl)-5-methyl-7-[4-(naphthalen-1-ylmethoxy)phenyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | (7R)-N-(2,4-dimethylphenyl)-5-methyl-7-[4-(naphthalen-1-ylmethoxy)phenyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135905917 |
| Molecular Formula | C32H29N5O2 |
| Molecular Weight | 515.62 g/mol |
| Exact Mass | 515.23 |
| IUPAC Name | (7R)-N-(2,4-dimethylphenyl)-5-methyl-7-[4-(naphthalen-1-ylmethoxy)phenyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccc(C)cc2C)[C@@H](c2ccc(OCc3cccc4ccccc34)cc2)n2ncnc2N1 |
| InChI | InChI=1S/C32H29N5O2/c1-20-11-16-28(21(2)17-20)36-31(38)29-22(3)35-32-33-19-34-37(32)30(29)24-12-14-26(15-13-24)39-18-25-9-6-8-23-7-4-5-10-27(23)25/h4-17,19,30H,18H2,1-3H3,(H,36,38)(H,33,34,35)/t30-/m1/s1 |
| InChIKey | SBKGMZSKPHMXAF-SSEXGKCCSA-N |
| XLogP | 6.55 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.62 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |