C32H29N5O4 — CID 136800177
(7S)-N-(2,5-dimethoxyphenyl)-5-methyl-7-[3-(naphthalen-1-ylmethoxy)phenyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 136800177) has the molecular formula C32H29N5O4 and a molecular weight of 547.62 g/mol. Its IUPAC name is (7S)-N-(2,5-dimethoxyphenyl)-5-methyl-7-[3-(naphthalen-1-ylmethoxy)phenyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | (7S)-N-(2,5-dimethoxyphenyl)-5-methyl-7-[3-(naphthalen-1-ylmethoxy)phenyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 136800177 |
| Molecular Formula | C32H29N5O4 |
| Molecular Weight | 547.62 g/mol |
| Exact Mass | 547.22 |
| IUPAC Name | (7S)-N-(2,5-dimethoxyphenyl)-5-methyl-7-[3-(naphthalen-1-ylmethoxy)phenyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | COc1ccc(OC)c(NC(=O)C2=C(C)Nc3ncnn3[C@H]2c2cccc(OCc3cccc4ccccc34)c2)c1 |
| InChI | InChI=1S/C32H29N5O4/c1-20-29(31(38)36-27-17-24(39-2)14-15-28(27)40-3)30(37-32(35-20)33-19-34-37)22-10-7-12-25(16-22)41-18-23-11-6-9-21-8-4-5-13-26(21)23/h4-17,19,30H,18H2,1-3H3,(H,36,38)(H,33,34,35)/t30-/m0/s1 |
| InChIKey | JJWHGQINNYXCAJ-PMERELPUSA-N |
| XLogP | 5.96 |
| TPSA | 99.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.62 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |