C14H9Br2ClN2O3 — CID 135579320
4-chloro-N-[(E)-(3,5-dibromo-2,4-dihydroxyphenyl)methylideneamino]benzamide (PubChem CID 135579320) has the molecular formula C14H9Br2ClN2O3 and a molecular weight of 448.50 g/mol. Its IUPAC name is 4-chloro-N-[(E)-(3,5-dibromo-2,4-dihydroxyphenyl)methylideneamino]benzamide.
| Compound Name | 4-chloro-N-[(E)-(3,5-dibromo-2,4-dihydroxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 135579320 |
| Molecular Formula | C14H9Br2ClN2O3 |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 445.87 |
| IUPAC Name | 4-chloro-N-[(E)-(3,5-dibromo-2,4-dihydroxyphenyl)methylideneamino]benzamide |
| SMILES | O=C(N/N=C/c1cc(Br)c(O)c(Br)c1O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H9Br2ClN2O3/c15-10-5-8(12(20)11(16)13(10)21)6-18-19-14(22)7-1-3-9(17)4-2-7/h1-6,20-21H,(H,19,22)/b18-6+ |
| InChIKey | ZDMUFSJTENTNDA-NGYBGAFCSA-N |
| XLogP | 4.04 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|