C10H11N5O2 — CID 135580435
1-[(E)-1-(1H-benzimidazol-2-yl)ethylideneamino]-3-hydroxyurea (PubChem CID 135580435) has the molecular formula C10H11N5O2 and a molecular weight of 233.23 g/mol. Its IUPAC name is 1-[(E)-1-(1H-benzimidazol-2-yl)ethylideneamino]-3-hydroxyurea.
| Compound Name | 1-[(E)-1-(1H-benzimidazol-2-yl)ethylideneamino]-3-hydroxyurea |
|---|---|
| PubChem CID | 135580435 |
| Molecular Formula | C10H11N5O2 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | 1-[(E)-1-(1H-benzimidazol-2-yl)ethylideneamino]-3-hydroxyurea |
| SMILES | C/C(=N\NC(=O)NO)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C10H11N5O2/c1-6(13-14-10(16)15-17)9-11-7-4-2-3-5-8(7)12-9/h2-5,17H,1H3,(H,11,12)(H2,14,15,16)/b13-6+ |
| InChIKey | AMBLYIYMWRVHGB-AWNIVKPZSA-N |
| XLogP | 0.98 |
| TPSA | 102.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|