C22H20N6 — CID 135773416
N-[(E)-[(1E)-1-(1H-benzimidazol-2-yl)-1-(phenylhydrazinylidene)propan-2-ylidene]amino]aniline (PubChem CID 135773416) has the molecular formula C22H20N6 and a molecular weight of 368.44 g/mol. Its IUPAC name is N-[(E)-[(1E)-1-(1H-benzimidazol-2-yl)-1-(phenylhydrazinylidene)propan-2-ylidene]amino]aniline.
| Compound Name | N-[(E)-[(1E)-1-(1H-benzimidazol-2-yl)-1-(phenylhydrazinylidene)propan-2-ylidene]amino]aniline |
|---|---|
| PubChem CID | 135773416 |
| Molecular Formula | C22H20N6 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | N-[(E)-[(1E)-1-(1H-benzimidazol-2-yl)-1-(phenylhydrazinylidene)propan-2-ylidene]amino]aniline |
| SMILES | CC(=N\Nc1ccccc1)/C(=N\Nc1ccccc1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C22H20N6/c1-16(25-26-17-10-4-2-5-11-17)21(28-27-18-12-6-3-7-13-18)22-23-19-14-8-9-15-20(19)24-22/h2-15,26-27H,1H3,(H,23,24)/b25-16+,28-21+ |
| InChIKey | GMXBBYKCDCOUPQ-GLLJMYQNSA-N |
| XLogP | 4.87 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|