C22H18N6O — CID 135921055
N-[bis(1H-benzimidazol-2-yl)methylideneamino]-4-methoxyaniline (PubChem CID 135921055) has the molecular formula C22H18N6O and a molecular weight of 382.43 g/mol. Its IUPAC name is N-[bis(1H-benzimidazol-2-yl)methylideneamino]-4-methoxyaniline.
| Compound Name | N-[bis(1H-benzimidazol-2-yl)methylideneamino]-4-methoxyaniline |
|---|---|
| PubChem CID | 135921055 |
| Molecular Formula | C22H18N6O |
| Molecular Weight | 382.43 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | N-[bis(1H-benzimidazol-2-yl)methylideneamino]-4-methoxyaniline |
| SMILES | COc1ccc(NN=C(c2nc3ccccc3[nH]2)c2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C22H18N6O/c1-29-15-12-10-14(11-13-15)27-28-20(21-23-16-6-2-3-7-17(16)24-21)22-25-18-8-4-5-9-19(18)26-22/h2-13,27H,1H3,(H,23,24)(H,25,26) |
| InChIKey | SVCDBBLRGHOXFK-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.43 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|