C22H11F5N4O2 — CID 171981705
3-[(E)-N-anilino-C-(2,3,4,5,6-pentafluorobenzoyl)carbonimidoyl]-1H-quinoxalin-2-one (PubChem CID 171981705) has the molecular formula C22H11F5N4O2 and a molecular weight of 458.35 g/mol. Its IUPAC name is 3-[(E)-N-anilino-C-(2,3,4,5,6-pentafluorobenzoyl)carbonimidoyl]-1H-quinoxalin-2-one.
| Compound Name | 3-[(E)-N-anilino-C-(2,3,4,5,6-pentafluorobenzoyl)carbonimidoyl]-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 171981705 |
| Molecular Formula | C22H11F5N4O2 |
| Molecular Weight | 458.35 g/mol |
| Exact Mass | 458.08 |
| IUPAC Name | 3-[(E)-N-anilino-C-(2,3,4,5,6-pentafluorobenzoyl)carbonimidoyl]-1H-quinoxalin-2-one |
| SMILES | O=C(/C(=N/Nc1ccccc1)c1nc2ccccc2[nH]c1=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C22H11F5N4O2/c23-14-13(15(24)17(26)18(27)16(14)25)21(32)19(31-30-10-6-2-1-3-7-10)20-22(33)29-12-9-5-4-8-11(12)28-20/h1-9,30H,(H,29,33)/b31-19+ |
| InChIKey | ZCYGTKRRUVAIMK-ZCTHSVRISA-N |
| XLogP | 4.32 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.35 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|